C24H24F3N3O5S — CID 70036050
N-[2-hydroxy-5-[(1S)-1-hydroxy-2-[2-[[7-(trifluoromethyl)-9H-carbazol-2-yl]oxy]ethylamino]ethyl]phenyl]methanesulfonamide (PubChem CID 70036050) has the molecular formula C24H24F3N3O5S and a molecular weight of 523.53 g/mol. Its IUPAC name is N-[2-hydroxy-5-[(1S)-1-hydroxy-2-[2-[[7-(trifluoromethyl)-9H-carbazol-2-yl]oxy]ethylamino]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-hydroxy-5-[(1S)-1-hydroxy-2-[2-[[7-(trifluoromethyl)-9H-carbazol-2-yl]oxy]ethylamino]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70036050 |
| Molecular Formula | C24H24F3N3O5S |
| Molecular Weight | 523.53 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | N-[2-hydroxy-5-[(1S)-1-hydroxy-2-[2-[[7-(trifluoromethyl)-9H-carbazol-2-yl]oxy]ethylamino]ethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc([C@H](O)CNCCOc2ccc3c(c2)[nH]c2cc(C(F)(F)F)ccc23)ccc1O |
| InChI | InChI=1S/C24H24F3N3O5S/c1-36(33,34)30-21-10-14(2-7-22(21)31)23(32)13-28-8-9-35-16-4-6-18-17-5-3-15(24(25,26)27)11-19(17)29-20(18)12-16/h2-7,10-12,23,28-32H,8-9,13H2,1H3/t23-/m1/s1 |
| InChIKey | XJAHCARILUSQHX-HSZRJFAPSA-N |
| XLogP | 4.12 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|