C24H23BrN4O4S — CID 70034319
N-[2-bromo-5-[(1S)-2-[2-[(7-cyano-9H-carbazol-2-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide (PubChem CID 70034319) has the molecular formula C24H23BrN4O4S and a molecular weight of 543.44 g/mol. Its IUPAC name is N-[2-bromo-5-[(1S)-2-[2-[(7-cyano-9H-carbazol-2-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-bromo-5-[(1S)-2-[2-[(7-cyano-9H-carbazol-2-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70034319 |
| Molecular Formula | C24H23BrN4O4S |
| Molecular Weight | 543.44 g/mol |
| Exact Mass | 542.06 |
| IUPAC Name | N-[2-bromo-5-[(1S)-2-[2-[(7-cyano-9H-carbazol-2-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc([C@H](O)CNCCOc2ccc3c(c2)[nH]c2cc(C#N)ccc23)ccc1Br |
| InChI | InChI=1S/C24H23BrN4O4S/c1-34(31,32)29-23-11-16(3-7-20(23)25)24(30)14-27-8-9-33-17-4-6-19-18-5-2-15(13-26)10-21(18)28-22(19)12-17/h2-7,10-12,24,27-30H,8-9,14H2,1H3/t24-/m1/s1 |
| InChIKey | WTLXZCFGKLXEPI-XMMPIXPASA-N |
| XLogP | 4.03 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|