C24H30FN3O6S — CID 10279037
ethyl 2-[6-[2-[[(2R)-2-[4-fluoro-3-(methanesulfonamido)phenyl]-2-hydroxyethyl]amino]ethoxy]-2-methyl-1H-indol-3-yl]acetate (PubChem CID 10279037) has the molecular formula C24H30FN3O6S and a molecular weight of 507.58 g/mol. Its IUPAC name is ethyl 2-[6-[2-[[(2R)-2-[4-fluoro-3-(methanesulfonamido)phenyl]-2-hydroxyethyl]amino]ethoxy]-2-methyl-1H-indol-3-yl]acetate.
| Compound Name | ethyl 2-[6-[2-[[(2R)-2-[4-fluoro-3-(methanesulfonamido)phenyl]-2-hydroxyethyl]amino]ethoxy]-2-methyl-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 10279037 |
| Molecular Formula | C24H30FN3O6S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | ethyl 2-[6-[2-[[(2R)-2-[4-fluoro-3-(methanesulfonamido)phenyl]-2-hydroxyethyl]amino]ethoxy]-2-methyl-1H-indol-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C)[nH]c2cc(OCCNC[C@H](O)c3ccc(F)c(NS(C)(=O)=O)c3)ccc12 |
| InChI | InChI=1S/C24H30FN3O6S/c1-4-33-24(30)13-19-15(2)27-21-12-17(6-7-18(19)21)34-10-9-26-14-23(29)16-5-8-20(25)22(11-16)28-35(3,31)32/h5-8,11-12,23,26-29H,4,9-10,13-14H2,1-3H3/t23-/m0/s1 |
| InChIKey | YYZASNBRKDQECM-QHCPKHFHSA-N |
| XLogP | 2.79 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|