C23H24ClN3O5S — CID 10206627
N-[2-chloro-5-[(1S)-1-hydroxy-2-[2-[(7-hydroxy-9H-carbazol-2-yl)oxy]ethylamino]ethyl]phenyl]methanesulfonamide (PubChem CID 10206627) has the molecular formula C23H24ClN3O5S and a molecular weight of 489.98 g/mol. Its IUPAC name is N-[2-chloro-5-[(1S)-1-hydroxy-2-[2-[(7-hydroxy-9H-carbazol-2-yl)oxy]ethylamino]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[(1S)-1-hydroxy-2-[2-[(7-hydroxy-9H-carbazol-2-yl)oxy]ethylamino]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 10206627 |
| Molecular Formula | C23H24ClN3O5S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | N-[2-chloro-5-[(1S)-1-hydroxy-2-[2-[(7-hydroxy-9H-carbazol-2-yl)oxy]ethylamino]ethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc([C@H](O)CNCCOc2ccc3c(c2)[nH]c2cc(O)ccc23)ccc1Cl |
| InChI | InChI=1S/C23H24ClN3O5S/c1-33(30,31)27-22-10-14(2-7-19(22)24)23(29)13-25-8-9-32-16-4-6-18-17-5-3-15(28)11-20(17)26-21(18)12-16/h2-7,10-12,23,25-29H,8-9,13H2,1H3/t23-/m1/s1 |
| InChIKey | CVTDCZZWSTUEGR-HSZRJFAPSA-N |
| XLogP | 3.75 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|