C19H20ClF3N4O4S — CID 45380468
N-[2-chloro-5-[(1R)-1-hydroxy-2-[2-[[3-(trifluoromethyl)-2H-indazol-6-yl]oxy]ethylamino]ethyl]phenyl]methanesulfonamide (PubChem CID 45380468) has the molecular formula C19H20ClF3N4O4S and a molecular weight of 492.91 g/mol. Its IUPAC name is N-[2-chloro-5-[(1R)-1-hydroxy-2-[2-[[3-(trifluoromethyl)-2H-indazol-6-yl]oxy]ethylamino]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[(1R)-1-hydroxy-2-[2-[[3-(trifluoromethyl)-2H-indazol-6-yl]oxy]ethylamino]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 45380468 |
| Molecular Formula | C19H20ClF3N4O4S |
| Molecular Weight | 492.91 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | N-[2-chloro-5-[(1R)-1-hydroxy-2-[2-[[3-(trifluoromethyl)-2H-indazol-6-yl]oxy]ethylamino]ethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc([C@@H](O)CNCCOc2ccc3c(C(F)(F)F)[nH]nc3c2)ccc1Cl |
| InChI | InChI=1S/C19H20ClF3N4O4S/c1-32(29,30)27-16-8-11(2-5-14(16)20)17(28)10-24-6-7-31-12-3-4-13-15(9-12)25-26-18(13)19(21,22)23/h2-5,8-9,17,24,27-28H,6-7,10H2,1H3,(H,25,26)/t17-/m0/s1 |
| InChIKey | TYFKQJYMVKKSTN-KRWDZBQOSA-N |
| XLogP | 3.31 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.91 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|