C23H28ClN3O5S — CID 10300261
N-[2-chloro-5-[(1S)-1-hydroxy-2-[2-[4-(2-propan-2-yl-1,3-oxazol-4-yl)phenoxy]ethylamino]ethyl]phenyl]methanesulfonamide (PubChem CID 10300261) has the molecular formula C23H28ClN3O5S and a molecular weight of 494.01 g/mol. Its IUPAC name is N-[2-chloro-5-[(1S)-1-hydroxy-2-[2-[4-(2-propan-2-yl-1,3-oxazol-4-yl)phenoxy]ethylamino]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[(1S)-1-hydroxy-2-[2-[4-(2-propan-2-yl-1,3-oxazol-4-yl)phenoxy]ethylamino]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 10300261 |
| Molecular Formula | C23H28ClN3O5S |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | N-[2-chloro-5-[(1S)-1-hydroxy-2-[2-[4-(2-propan-2-yl-1,3-oxazol-4-yl)phenoxy]ethylamino]ethyl]phenyl]methanesulfonamide |
| SMILES | CC(C)c1nc(-c2ccc(OCCNC[C@@H](O)c3ccc(Cl)c(NS(C)(=O)=O)c3)cc2)co1 |
| InChI | InChI=1S/C23H28ClN3O5S/c1-15(2)23-26-21(14-32-23)16-4-7-18(8-5-16)31-11-10-25-13-22(28)17-6-9-19(24)20(12-17)27-33(3,29)30/h4-9,12,14-15,22,25,27-28H,10-11,13H2,1-3H3/t22-/m1/s1 |
| InChIKey | PMZDJCNUGXQSRS-JOCHJYFZSA-N |
| XLogP | 4.19 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|