C9H11BrClNO3S — CID 18615156
N-[5-(2-bromo-1-hydroxyethyl)-2-chlorophenyl]methanesulfonamide (PubChem CID 18615156) has the molecular formula C9H11BrClNO3S and a molecular weight of 328.62 g/mol. Its IUPAC name is N-[5-(2-bromo-1-hydroxyethyl)-2-chlorophenyl]methanesulfonamide.
| Compound Name | N-[5-(2-bromo-1-hydroxyethyl)-2-chlorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 18615156 |
| Molecular Formula | C9H11BrClNO3S |
| Molecular Weight | 328.62 g/mol |
| Exact Mass | 326.93 |
| IUPAC Name | N-[5-(2-bromo-1-hydroxyethyl)-2-chlorophenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(O)CBr)ccc1Cl |
| InChI | InChI=1S/C9H11BrClNO3S/c1-16(14,15)12-8-4-6(9(13)5-10)2-3-7(8)11/h2-4,9,12-13H,5H2,1H3 |
| InChIKey | ZLPCLSFBJAEOGE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.62 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|