C21H27Cl2N3O4S — CID 22141438
N-[2-chloro-5-[2-[2-[(2,3-dimethyl-1H-indol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide;hydrochloride (PubChem CID 22141438) has the molecular formula C21H27Cl2N3O4S and a molecular weight of 488.44 g/mol. Its IUPAC name is N-[2-chloro-5-[2-[2-[(2,3-dimethyl-1H-indol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[2-chloro-5-[2-[2-[(2,3-dimethyl-1H-indol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22141438 |
| Molecular Formula | C21H27Cl2N3O4S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | N-[2-chloro-5-[2-[2-[(2,3-dimethyl-1H-indol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide;hydrochloride |
| SMILES | Cc1[nH]c2cc(OCCNCC(O)c3ccc(Cl)c(NS(C)(=O)=O)c3)ccc2c1C.Cl |
| InChI | InChI=1S/C21H26ClN3O4S.ClH/c1-13-14(2)24-19-11-16(5-6-17(13)19)29-9-8-23-12-21(26)15-4-7-18(22)20(10-15)25-30(3,27)28;/h4-7,10-11,21,23-26H,8-9,12H2,1-3H3;1H |
| InChIKey | FNCNVCVHXZKVCS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|