C24H26ClN3O5S — CID 70036087
N-[2-chloro-5-[(1R)-1-hydroxy-2-[2-[(7-methoxy-9H-carbazol-2-yl)oxy]ethylamino]ethyl]phenyl]methanesulfonamide (PubChem CID 70036087) has the molecular formula C24H26ClN3O5S and a molecular weight of 504.01 g/mol. Its IUPAC name is N-[2-chloro-5-[(1R)-1-hydroxy-2-[2-[(7-methoxy-9H-carbazol-2-yl)oxy]ethylamino]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[(1R)-1-hydroxy-2-[2-[(7-methoxy-9H-carbazol-2-yl)oxy]ethylamino]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70036087 |
| Molecular Formula | C24H26ClN3O5S |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | N-[2-chloro-5-[(1R)-1-hydroxy-2-[2-[(7-methoxy-9H-carbazol-2-yl)oxy]ethylamino]ethyl]phenyl]methanesulfonamide |
| SMILES | COc1ccc2c(c1)[nH]c1cc(OCCNC[C@H](O)c3ccc(Cl)c(NS(C)(=O)=O)c3)ccc12 |
| InChI | InChI=1S/C24H26ClN3O5S/c1-32-16-4-6-18-19-7-5-17(13-22(19)27-21(18)12-16)33-10-9-26-14-24(29)15-3-8-20(25)23(11-15)28-34(2,30)31/h3-8,11-13,24,26-29H,9-10,14H2,1-2H3/t24-/m0/s1 |
| InChIKey | XROOMTKBTBNAHE-DEOSSOPVSA-N |
| XLogP | 4.06 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|