C12H19ClN2O3S — CID 162345152
N-[2-chloro-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl]methanesulfonamide (PubChem CID 162345152) has the molecular formula C12H19ClN2O3S and a molecular weight of 306.82 g/mol. Its IUPAC name is N-[2-chloro-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-chloro-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 162345152 |
| Molecular Formula | C12H19ClN2O3S |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-[2-chloro-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl]methanesulfonamide |
| SMILES | CC(C)NCC(O)c1ccc(NS(C)(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C12H19ClN2O3S/c1-8(2)14-7-12(16)9-4-5-11(10(13)6-9)15-19(3,17)18/h4-6,8,12,14-16H,7H2,1-3H3 |
| InChIKey | GFLNEYSEGMKZOG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |