C26H33ClN4O4 — CID 22560774
2-[4-[4-[2-[[2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-1,3-oxazol-2-yl]-N,N-di(propan-2-yl)acetamide (PubChem CID 22560774) has the molecular formula C26H33ClN4O4 and a molecular weight of 501.03 g/mol. Its IUPAC name is 2-[4-[4-[2-[[2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-1,3-oxazol-2-yl]-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-[4-[4-[2-[[2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-1,3-oxazol-2-yl]-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 22560774 |
| Molecular Formula | C26H33ClN4O4 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2-[4-[4-[2-[[2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-1,3-oxazol-2-yl]-N,N-di(propan-2-yl)acetamide |
| SMILES | CC(C)N(C(=O)Cc1nc(-c2ccc(OCCNCC(O)c3ccc(Cl)nc3)cc2)co1)C(C)C |
| InChI | InChI=1S/C26H33ClN4O4/c1-17(2)31(18(3)4)26(33)13-25-30-22(16-35-25)19-5-8-21(9-6-19)34-12-11-28-15-23(32)20-7-10-24(27)29-14-20/h5-10,14,16-18,23,28,32H,11-13,15H2,1-4H3 |
| InChIKey | KOFPZCLDERQXTM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|