C25H21ClF3N3O2S — CID 87975624
(1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]phenoxy]ethylamino]ethanol (PubChem CID 87975624) has the molecular formula C25H21ClF3N3O2S and a molecular weight of 519.98 g/mol. Its IUPAC name is (1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]phenoxy]ethylamino]ethanol.
| Compound Name | (1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]phenoxy]ethylamino]ethanol |
|---|---|
| PubChem CID | 87975624 |
| Molecular Formula | C25H21ClF3N3O2S |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | (1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]phenoxy]ethylamino]ethanol |
| SMILES | O[C@@H](CNCCOc1ccc(-c2csc(-c3ccc(C(F)(F)F)cc3)n2)cc1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C25H21ClF3N3O2S/c26-23-10-5-18(13-31-23)22(33)14-30-11-12-34-20-8-3-16(4-9-20)21-15-35-24(32-21)17-1-6-19(7-2-17)25(27,28)29/h1-10,13,15,22,30,33H,11-12,14H2/t22-/m0/s1 |
| InChIKey | VJIZQNDWUOUTAE-QFIPXVFZSA-N |
| XLogP | 6.25 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|