C21H24ClN3O3 — CID 87975517
(1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-(2-propan-2-yl-1,3-oxazol-4-yl)phenoxy]ethylamino]ethanol (PubChem CID 87975517) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is (1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-(2-propan-2-yl-1,3-oxazol-4-yl)phenoxy]ethylamino]ethanol.
| Compound Name | (1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-(2-propan-2-yl-1,3-oxazol-4-yl)phenoxy]ethylamino]ethanol |
|---|---|
| PubChem CID | 87975517 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-(2-propan-2-yl-1,3-oxazol-4-yl)phenoxy]ethylamino]ethanol |
| SMILES | CC(C)c1nc(-c2ccc(OCCNC[C@H](O)c3ccc(Cl)nc3)cc2)co1 |
| InChI | InChI=1S/C21H24ClN3O3/c1-14(2)21-25-18(13-28-21)15-3-6-17(7-4-15)27-10-9-23-12-19(26)16-5-8-20(22)24-11-16/h3-8,11,13-14,19,23,26H,9-10,12H2,1-2H3/t19-/m0/s1 |
| InChIKey | NYURNSYGMIYIFM-IBGZPJMESA-N |
| XLogP | 4.22 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|