C25H26N4O2S — CID 10114560
(1R)-2-[2-[4-[2-(2-ethyl-4-pyridinyl)-1,3-thiazol-4-yl]phenoxy]ethylamino]-1-pyridin-3-ylethanol (PubChem CID 10114560) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is (1R)-2-[2-[4-[2-(2-ethyl-4-pyridinyl)-1,3-thiazol-4-yl]phenoxy]ethylamino]-1-pyridin-3-ylethanol.
| Compound Name | (1R)-2-[2-[4-[2-(2-ethyl-4-pyridinyl)-1,3-thiazol-4-yl]phenoxy]ethylamino]-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 10114560 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (1R)-2-[2-[4-[2-(2-ethyl-4-pyridinyl)-1,3-thiazol-4-yl]phenoxy]ethylamino]-1-pyridin-3-ylethanol |
| SMILES | CCc1cc(-c2nc(-c3ccc(OCCNC[C@H](O)c4cccnc4)cc3)cs2)ccn1 |
| InChI | InChI=1S/C25H26N4O2S/c1-2-21-14-19(9-11-28-21)25-29-23(17-32-25)18-5-7-22(8-6-18)31-13-12-27-16-24(30)20-4-3-10-26-15-20/h3-11,14-15,17,24,27,30H,2,12-13,16H2,1H3/t24-/m0/s1 |
| InChIKey | RQMILMBHPRWYQQ-DEOSSOPVSA-N |
| XLogP | 4.53 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|