C26H26N4O3S — CID 11677232
N'-hydroxy-4-[5-[4-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenoxy]pentoxy]benzenecarboximidamide (PubChem CID 11677232) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is N'-hydroxy-4-[5-[4-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenoxy]pentoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[5-[4-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenoxy]pentoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 11677232 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N'-hydroxy-4-[5-[4-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenoxy]pentoxy]benzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(OCCCCCOc2ccc(-c3csc(-c4cccnc4)n3)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O3S/c27-25(30-31)20-8-12-23(13-9-20)33-16-3-1-2-15-32-22-10-6-19(7-11-22)24-18-34-26(29-24)21-5-4-14-28-17-21/h4-14,17-18,31H,1-3,15-16H2,(H2,27,30) |
| InChIKey | JWWJFRKREJAUCG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|