C21H24N4O2S — CID 24896460
1-(4-hexoxyphenyl)-1-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea (PubChem CID 24896460) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-(4-hexoxyphenyl)-1-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(4-hexoxyphenyl)-1-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 24896460 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-(4-hexoxyphenyl)-1-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea |
| SMILES | CCCCCCOc1ccc(N(C(N)=O)c2nc(-c3cccnc3)cs2)cc1 |
| InChI | InChI=1S/C21H24N4O2S/c1-2-3-4-5-13-27-18-10-8-17(9-11-18)25(20(22)26)21-24-19(15-28-21)16-7-6-12-23-14-16/h6-12,14-15H,2-5,13H2,1H3,(H2,22,26) |
| InChIKey | LSQGZKVSOGEIHG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|