C22H23F3N4O2S — CID 24896071
1-[4-(2-methyl-3-pyridinyl)-1,3-thiazol-2-yl]-1-[4-pentoxy-3-(trifluoromethyl)phenyl]urea (PubChem CID 24896071) has the molecular formula C22H23F3N4O2S and a molecular weight of 464.51 g/mol. Its IUPAC name is 1-[4-(2-methyl-3-pyridinyl)-1,3-thiazol-2-yl]-1-[4-pentoxy-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(2-methyl-3-pyridinyl)-1,3-thiazol-2-yl]-1-[4-pentoxy-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 24896071 |
| Molecular Formula | C22H23F3N4O2S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 1-[4-(2-methyl-3-pyridinyl)-1,3-thiazol-2-yl]-1-[4-pentoxy-3-(trifluoromethyl)phenyl]urea |
| SMILES | CCCCCOc1ccc(N(C(N)=O)c2nc(-c3cccnc3C)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H23F3N4O2S/c1-3-4-5-11-31-19-9-8-15(12-17(19)22(23,24)25)29(20(26)30)21-28-18(13-32-21)16-7-6-10-27-14(16)2/h6-10,12-13H,3-5,11H2,1-2H3,(H2,26,30) |
| InChIKey | XNPZBGSSIYIMMD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|