C27H30F3N3O2S — CID 24896501
N-[4-pentoxy-3-(trifluoromethyl)phenyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)cyclohexanecarboxamide (PubChem CID 24896501) has the molecular formula C27H30F3N3O2S and a molecular weight of 517.62 g/mol. Its IUPAC name is N-[4-pentoxy-3-(trifluoromethyl)phenyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)cyclohexanecarboxamide.
| Compound Name | N-[4-pentoxy-3-(trifluoromethyl)phenyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 24896501 |
| Molecular Formula | C27H30F3N3O2S |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | N-[4-pentoxy-3-(trifluoromethyl)phenyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)cyclohexanecarboxamide |
| SMILES | CCCCCOc1ccc(N(C(=O)C2CCCCC2)c2nc(-c3cccnc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C27H30F3N3O2S/c1-2-3-7-15-35-24-13-12-21(16-22(24)27(28,29)30)33(25(34)19-9-5-4-6-10-19)26-32-23(18-36-26)20-11-8-14-31-17-20/h8,11-14,16-19H,2-7,9-10,15H2,1H3 |
| InChIKey | LJVXLITVSKLHPJ-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|