C24H27F2N3OS — CID 58966366
N-[4-(1,1-difluorooctyl)phenyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 58966366) has the molecular formula C24H27F2N3OS and a molecular weight of 443.56 g/mol. Its IUPAC name is N-[4-(1,1-difluorooctyl)phenyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[4-(1,1-difluorooctyl)phenyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 58966366 |
| Molecular Formula | C24H27F2N3OS |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-[4-(1,1-difluorooctyl)phenyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCCCCCCC(F)(F)c1ccc(N(C(C)=O)c2nc(-c3cccnc3)cs2)cc1 |
| InChI | InChI=1S/C24H27F2N3OS/c1-3-4-5-6-7-14-24(25,26)20-10-12-21(13-11-20)29(18(2)30)23-28-22(17-31-23)19-9-8-15-27-16-19/h8-13,15-17H,3-7,14H2,1-2H3 |
| InChIKey | JWWJBXAOUBQPGP-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|