C22H21F3N4O3S — CID 58966267
N'-[4-pentoxy-3-(trifluoromethyl)phenyl]-N'-(4-pyridin-3-yl-1,3-thiazol-2-yl)oxamide (PubChem CID 58966267) has the molecular formula C22H21F3N4O3S and a molecular weight of 478.50 g/mol. Its IUPAC name is N'-[4-pentoxy-3-(trifluoromethyl)phenyl]-N'-(4-pyridin-3-yl-1,3-thiazol-2-yl)oxamide.
| Compound Name | N'-[4-pentoxy-3-(trifluoromethyl)phenyl]-N'-(4-pyridin-3-yl-1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 58966267 |
| Molecular Formula | C22H21F3N4O3S |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N'-[4-pentoxy-3-(trifluoromethyl)phenyl]-N'-(4-pyridin-3-yl-1,3-thiazol-2-yl)oxamide |
| SMILES | CCCCCOc1ccc(N(C(=O)C(N)=O)c2nc(-c3cccnc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H21F3N4O3S/c1-2-3-4-10-32-18-8-7-15(11-16(18)22(23,24)25)29(20(31)19(26)30)21-28-17(13-33-21)14-6-5-9-27-12-14/h5-9,11-13H,2-4,10H2,1H3,(H2,26,30) |
| InChIKey | UMZIPZMNERPWKT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|