C33H44I3N3O3S — CID 143537014
[3-[1,1-bis(methylidene-λ3-iodanyl)ethyl]-N-[5-(methylidene-λ3-iodanyl)-4-pyridin-3-yl-1,3-thiazol-2-yl]-4-octoxyanilino]methyl 2,2-dimethylpropanoate (PubChem CID 143537014) has the molecular formula C33H44I3N3O3S and a molecular weight of 943.51 g/mol. Its IUPAC name is [3-[1,1-bis(methylidene-λ3-iodanyl)ethyl]-N-[5-(methylidene-λ3-iodanyl)-4-pyridin-3-yl-1,3-thiazol-2-yl]-4-octoxyanilino]methyl 2,2-dimethylpropanoate.
| Compound Name | [3-[1,1-bis(methylidene-λ3-iodanyl)ethyl]-N-[5-(methylidene-λ3-iodanyl)-4-pyridin-3-yl-1,3-thiazol-2-yl]-4-octoxyanilino]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 143537014 |
| Molecular Formula | C33H44I3N3O3S |
| Molecular Weight | 943.51 g/mol |
| Exact Mass | 943.02 |
| IUPAC Name | [3-[1,1-bis(methylidene-λ3-iodanyl)ethyl]-N-[5-(methylidene-λ3-iodanyl)-4-pyridin-3-yl-1,3-thiazol-2-yl]-4-octoxyanilino]methyl 2,2-dimethylpropanoate |
| SMILES | C=Ic1sc(N(COC(=O)C(C)(C)C)c2ccc(OCCCCCCCC)c(C(C)(I=C)I=C)c2)nc1-c1cccnc1 |
| InChI | InChI=1S/C33H44I3N3O3S/c1-9-10-11-12-13-14-20-41-27-18-17-25(21-26(27)33(5,35-7)36-8)39(23-42-30(40)32(2,3)4)31-38-28(29(34-6)43-31)24-16-15-19-37-22-24/h15-19,21-22H,6-14,20,23H2,1-5H3 |
| InChIKey | PMEDOUZOTHDCKY-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.51 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|