C28H34F4N4OS — CID 24896280
2-amino-N-(5-fluoro-4-pyridin-3-yl-1,3-thiazol-2-yl)-3-methyl-N-[4-octyl-3-(trifluoromethyl)phenyl]butanamide (PubChem CID 24896280) has the molecular formula C28H34F4N4OS and a molecular weight of 550.67 g/mol. Its IUPAC name is 2-amino-N-(5-fluoro-4-pyridin-3-yl-1,3-thiazol-2-yl)-3-methyl-N-[4-octyl-3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2-amino-N-(5-fluoro-4-pyridin-3-yl-1,3-thiazol-2-yl)-3-methyl-N-[4-octyl-3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 24896280 |
| Molecular Formula | C28H34F4N4OS |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 2-amino-N-(5-fluoro-4-pyridin-3-yl-1,3-thiazol-2-yl)-3-methyl-N-[4-octyl-3-(trifluoromethyl)phenyl]butanamide |
| SMILES | CCCCCCCCc1ccc(N(C(=O)C(N)C(C)C)c2nc(-c3cccnc3)c(F)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C28H34F4N4OS/c1-4-5-6-7-8-9-11-19-13-14-21(16-22(19)28(30,31)32)36(26(37)23(33)18(2)3)27-35-24(25(29)38-27)20-12-10-15-34-17-20/h10,12-18,23H,4-9,11,33H2,1-3H3 |
| InChIKey | YRWUEGGBVLPATJ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|