C28H26F3N3O2S — CID 123767053
N-[4-pentoxy-3-(trifluoromethyl)phenyl]-2-phenyl-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 123767053) has the molecular formula C28H26F3N3O2S and a molecular weight of 525.60 g/mol. Its IUPAC name is N-[4-pentoxy-3-(trifluoromethyl)phenyl]-2-phenyl-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[4-pentoxy-3-(trifluoromethyl)phenyl]-2-phenyl-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 123767053 |
| Molecular Formula | C28H26F3N3O2S |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | N-[4-pentoxy-3-(trifluoromethyl)phenyl]-2-phenyl-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCCCCOc1ccc(N(C(=O)Cc2ccccc2)c2nc(-c3cccnc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C28H26F3N3O2S/c1-2-3-7-15-36-25-13-12-22(17-23(25)28(29,30)31)34(26(35)16-20-9-5-4-6-10-20)27-33-24(19-37-27)21-11-8-14-32-18-21/h4-6,8-14,17-19H,2-3,7,15-16H2,1H3 |
| InChIKey | QJEPGNGUFKXPGN-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|