C23H24F3N3OS — CID 58791229
N-[4-[(Z)-oct-5-enoxy]-3-(trifluoromethyl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine (PubChem CID 58791229) has the molecular formula C23H24F3N3OS and a molecular weight of 447.53 g/mol. Its IUPAC name is N-[4-[(Z)-oct-5-enoxy]-3-(trifluoromethyl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine.
| Compound Name | N-[4-[(Z)-oct-5-enoxy]-3-(trifluoromethyl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791229 |
| Molecular Formula | C23H24F3N3OS |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[4-[(Z)-oct-5-enoxy]-3-(trifluoromethyl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine |
| SMILES | CC/C=C\CCCCOc1ccc(Nc2nc(-c3cccnc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H24F3N3OS/c1-2-3-4-5-6-7-13-30-21-11-10-18(14-19(21)23(24,25)26)28-22-29-20(16-31-22)17-9-8-12-27-15-17/h3-4,8-12,14-16H,2,5-7,13H2,1H3,(H,28,29)/b4-3- |
| InChIKey | FIGASDUSTFITSP-ARJAWSKDSA-N |
| XLogP | 7.48 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|