C23H22F3N3S — CID 58791342
N-[4-oct-1-ynyl-3-(trifluoromethyl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine (PubChem CID 58791342) has the molecular formula C23H22F3N3S and a molecular weight of 429.51 g/mol. Its IUPAC name is N-[4-oct-1-ynyl-3-(trifluoromethyl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine.
| Compound Name | N-[4-oct-1-ynyl-3-(trifluoromethyl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791342 |
| Molecular Formula | C23H22F3N3S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[4-oct-1-ynyl-3-(trifluoromethyl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine |
| SMILES | CCCCCCC#Cc1ccc(Nc2nc(-c3cccnc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H22F3N3S/c1-2-3-4-5-6-7-9-17-11-12-19(14-20(17)23(24,25)26)28-22-29-21(16-30-22)18-10-8-13-27-15-18/h8,10-16H,2-6H2,1H3,(H,28,29) |
| InChIKey | HNHAJVICKDFGQM-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|