C23H27F3N3O2S+ — CID 143328657
4-(1-hydroxypyridin-1-ium-3-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 143328657) has the molecular formula C23H27F3N3O2S+ and a molecular weight of 466.55 g/mol. Its IUPAC name is 4-(1-hydroxypyridin-1-ium-3-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(1-hydroxypyridin-1-ium-3-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 143328657 |
| Molecular Formula | C23H27F3N3O2S+ |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 4-(1-hydroxypyridin-1-ium-3-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCOc1ccc(Nc2nc(-c3ccc[n+](O)c3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H27F3N3O2S/c1-2-3-4-5-6-7-13-31-21-11-10-18(14-19(21)23(24,25)26)27-22-28-20(16-32-22)17-9-8-12-29(30)15-17/h8-12,14-16,30H,2-7,13H2,1H3,(H,27,28)/q+1 |
| InChIKey | IYBCAVADGGJKGD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 58.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|