C24H25F3N4O2S — CID 58791917
N-cyclopropyl-5-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-2-carboxamide (PubChem CID 58791917) has the molecular formula C24H25F3N4O2S and a molecular weight of 490.55 g/mol. Its IUPAC name is N-cyclopropyl-5-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-2-carboxamide.
| Compound Name | N-cyclopropyl-5-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58791917 |
| Molecular Formula | C24H25F3N4O2S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-cyclopropyl-5-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-2-carboxamide |
| SMILES | CCCCCOc1ccc(Nc2nc(-c3ccc(C(=O)NC4CC4)nc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H25F3N4O2S/c1-2-3-4-11-33-21-10-8-17(12-18(21)24(25,26)27)30-23-31-20(14-34-23)15-5-9-19(28-13-15)22(32)29-16-6-7-16/h5,8-10,12-14,16H,2-4,6-7,11H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | CVCGYIJSRCANJZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|