C24H27ClF3N3OS — CID 58791870
4-(6-chloro-5-methyl-3-pyridinyl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 58791870) has the molecular formula C24H27ClF3N3OS and a molecular weight of 498.01 g/mol. Its IUPAC name is 4-(6-chloro-5-methyl-3-pyridinyl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(6-chloro-5-methyl-3-pyridinyl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791870 |
| Molecular Formula | C24H27ClF3N3OS |
| Molecular Weight | 498.01 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 4-(6-chloro-5-methyl-3-pyridinyl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCOc1ccc(Nc2nc(-c3cnc(Cl)c(C)c3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H27ClF3N3OS/c1-3-4-5-6-7-8-11-32-21-10-9-18(13-19(21)24(26,27)28)30-23-31-20(15-33-23)17-12-16(2)22(25)29-14-17/h9-10,12-15H,3-8,11H2,1-2H3,(H,30,31) |
| InChIKey | GBZMFODCBCZKBN-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.01 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|