C28H39F3N2O3S — CID 143328650
ethane;4-[2-[4-octoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 143328650) has the molecular formula C28H39F3N2O3S and a molecular weight of 540.69 g/mol. Its IUPAC name is ethane;4-[2-[4-octoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]benzene-1,2-diol.
| Compound Name | ethane;4-[2-[4-octoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 143328650 |
| Molecular Formula | C28H39F3N2O3S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | ethane;4-[2-[4-octoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | CC.CC.CCCCCCCCOc1ccc(Nc2nc(-c3ccc(O)c(O)c3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H27F3N2O3S.2C2H6/c1-2-3-4-5-6-7-12-32-22-11-9-17(14-18(22)24(25,26)27)28-23-29-19(15-33-23)16-8-10-20(30)21(31)13-16;2*1-2/h8-11,13-15,30-31H,2-7,12H2,1H3,(H,28,29);2*1-2H3 |
| InChIKey | MOPPUPGJTUKIJW-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|