C21H21F3N2O3S2 — CID 58791490
2-[5-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]thiophen-2-yl]acetic acid (PubChem CID 58791490) has the molecular formula C21H21F3N2O3S2 and a molecular weight of 470.54 g/mol. Its IUPAC name is 2-[5-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 58791490 |
| Molecular Formula | C21H21F3N2O3S2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-[5-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]thiophen-2-yl]acetic acid |
| SMILES | CCCCCOc1ccc(Nc2nc(-c3ccc(CC(=O)O)s3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H21F3N2O3S2/c1-2-3-4-9-29-17-7-5-13(10-15(17)21(22,23)24)25-20-26-16(12-30-20)18-8-6-14(31-18)11-19(27)28/h5-8,10,12H,2-4,9,11H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | VLSNIWLWSOYNJQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|