C24H22F3N3OS — CID 58791436
N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine (PubChem CID 58791436) has the molecular formula C24H22F3N3OS and a molecular weight of 457.52 g/mol. Its IUPAC name is N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine.
| Compound Name | N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791436 |
| Molecular Formula | C24H22F3N3OS |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine |
| SMILES | CCCCCOc1ccc(Nc2nc(-c3cnc4ccccc4c3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H22F3N3OS/c1-2-3-6-11-31-22-10-9-18(13-19(22)24(25,26)27)29-23-30-21(15-32-23)17-12-16-7-4-5-8-20(16)28-14-17/h4-5,7-10,12-15H,2-3,6,11H2,1H3,(H,29,30) |
| InChIKey | KLDUSASVLXUTSI-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|