C25H29F3N4O3S — CID 87424031
methyl-[5-[2-[4-octoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-2-pyridinyl]carbamic acid (PubChem CID 87424031) has the molecular formula C25H29F3N4O3S and a molecular weight of 522.59 g/mol. Its IUPAC name is methyl-[5-[2-[4-octoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-2-pyridinyl]carbamic acid.
| Compound Name | methyl-[5-[2-[4-octoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 87424031 |
| Molecular Formula | C25H29F3N4O3S |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | methyl-[5-[2-[4-octoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-2-pyridinyl]carbamic acid |
| SMILES | CCCCCCCCOc1ccc(Nc2nc(-c3ccc(N(C)C(=O)O)nc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H29F3N4O3S/c1-3-4-5-6-7-8-13-35-21-11-10-18(14-19(21)25(26,27)28)30-23-31-20(16-36-23)17-9-12-22(29-15-17)32(2)24(33)34/h9-12,14-16H,3-8,13H2,1-2H3,(H,30,31)(H,33,34) |
| InChIKey | PFRWZMLYIBXACF-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|