C21H20F3N3O3S — CID 58791994
6-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-3-carboxylic acid (PubChem CID 58791994) has the molecular formula C21H20F3N3O3S and a molecular weight of 451.47 g/mol. Its IUPAC name is 6-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 58791994 |
| Molecular Formula | C21H20F3N3O3S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 6-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-3-carboxylic acid |
| SMILES | CCCCCOc1ccc(Nc2nc(-c3ccc(C(=O)O)cn3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H20F3N3O3S/c1-2-3-4-9-30-18-8-6-14(10-15(18)21(22,23)24)26-20-27-17(12-31-20)16-7-5-13(11-25-16)19(28)29/h5-8,10-12H,2-4,9H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | NORBDOFZPDLFML-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|