C20H19F4N3OS — CID 58791211
4-(6-fluoro-3-pyridinyl)-N-[4-pentoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 58791211) has the molecular formula C20H19F4N3OS and a molecular weight of 425.45 g/mol. Its IUPAC name is 4-(6-fluoro-3-pyridinyl)-N-[4-pentoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(6-fluoro-3-pyridinyl)-N-[4-pentoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791211 |
| Molecular Formula | C20H19F4N3OS |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 4-(6-fluoro-3-pyridinyl)-N-[4-pentoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CCCCCOc1ccc(Nc2nc(-c3ccc(F)nc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H19F4N3OS/c1-2-3-4-9-28-17-7-6-14(10-15(17)20(22,23)24)26-19-27-16(12-29-19)13-5-8-18(21)25-11-13/h5-8,10-12H,2-4,9H2,1H3,(H,26,27) |
| InChIKey | DZMFBOPNLKYPCS-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|