C20H19FN4OS — CID 58791523
5-[2-(3-fluoro-4-pentoxyanilino)-1,3-thiazol-4-yl]pyridine-2-carbonitrile (PubChem CID 58791523) has the molecular formula C20H19FN4OS and a molecular weight of 382.46 g/mol. Its IUPAC name is 5-[2-(3-fluoro-4-pentoxyanilino)-1,3-thiazol-4-yl]pyridine-2-carbonitrile.
| Compound Name | 5-[2-(3-fluoro-4-pentoxyanilino)-1,3-thiazol-4-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 58791523 |
| Molecular Formula | C20H19FN4OS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 5-[2-(3-fluoro-4-pentoxyanilino)-1,3-thiazol-4-yl]pyridine-2-carbonitrile |
| SMILES | CCCCCOc1ccc(Nc2nc(-c3ccc(C#N)nc3)cs2)cc1F |
| InChI | InChI=1S/C20H19FN4OS/c1-2-3-4-9-26-19-8-7-15(10-17(19)21)24-20-25-18(13-27-20)14-5-6-16(11-22)23-12-14/h5-8,10,12-13H,2-4,9H2,1H3,(H,24,25) |
| InChIKey | QPRBVBSUIXDFCW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|