C22H25F2N3OS — CID 58791205
4-(3,4-difluorophenyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine (PubChem CID 58791205) has the molecular formula C22H25F2N3OS and a molecular weight of 417.53 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3,4-difluorophenyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791205 |
| Molecular Formula | C22H25F2N3OS |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 4-(3,4-difluorophenyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCOc1ccc(Nc2nc(-c3ccc(F)c(F)c3)cs2)cn1 |
| InChI | InChI=1S/C22H25F2N3OS/c1-2-3-4-5-6-7-12-28-21-11-9-17(14-25-21)26-22-27-20(15-29-22)16-8-10-18(23)19(24)13-16/h8-11,13-15H,2-7,12H2,1H3,(H,26,27) |
| InChIKey | XZBJQIFYPPSNTH-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|