C20H20F2N2S — CID 58791311
4-(3,4-difluorophenyl)-N-(4-pentylphenyl)-1,3-thiazol-2-amine (PubChem CID 58791311) has the molecular formula C20H20F2N2S and a molecular weight of 358.46 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-N-(4-pentylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3,4-difluorophenyl)-N-(4-pentylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791311 |
| Molecular Formula | C20H20F2N2S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 4-(3,4-difluorophenyl)-N-(4-pentylphenyl)-1,3-thiazol-2-amine |
| SMILES | CCCCCc1ccc(Nc2nc(-c3ccc(F)c(F)c3)cs2)cc1 |
| InChI | InChI=1S/C20H20F2N2S/c1-2-3-4-5-14-6-9-16(10-7-14)23-20-24-19(13-25-20)15-8-11-17(21)18(22)12-15/h6-13H,2-5H2,1H3,(H,23,24) |
| InChIKey | FNUBRAYREJSNKS-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|