C20H23ClN2S2 — CID 58791925
4-(5-chlorothiophen-2-yl)-N-(4-heptylphenyl)-1,3-thiazol-2-amine (PubChem CID 58791925) has the molecular formula C20H23ClN2S2 and a molecular weight of 391.01 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-N-(4-heptylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(5-chlorothiophen-2-yl)-N-(4-heptylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791925 |
| Molecular Formula | C20H23ClN2S2 |
| Molecular Weight | 391.01 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-N-(4-heptylphenyl)-1,3-thiazol-2-amine |
| SMILES | CCCCCCCc1ccc(Nc2nc(-c3ccc(Cl)s3)cs2)cc1 |
| InChI | InChI=1S/C20H23ClN2S2/c1-2-3-4-5-6-7-15-8-10-16(11-9-15)22-20-23-17(14-24-20)18-12-13-19(21)25-18/h8-14H,2-7H2,1H3,(H,22,23) |
| InChIKey | PQMLKHLTQRLJJJ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.01 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|