C14H16N2O2S — CID 79024050
2-(4-butylanilino)-1,3-thiazole-4-carboxylic acid (PubChem CID 79024050) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-(4-butylanilino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(4-butylanilino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79024050 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-(4-butylanilino)-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCc1ccc(Nc2nc(C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C14H16N2O2S/c1-2-3-4-10-5-7-11(8-6-10)15-14-16-12(9-19-14)13(17)18/h5-9H,2-4H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | RZCGHJVRXRCWFP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |