About N-ethyl-4-nonylaniline
N-ethyl-4-nonylaniline (PubChem CID 154108619) has the molecular formula C17H29N
and a molecular weight of 247.43 g/mol. Its IUPAC name is N-ethyl-4-nonylaniline.
Molecular Properties
| Compound Name | N-ethyl-4-nonylaniline |
| PubChem CID | 154108619 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | N-ethyl-4-nonylaniline |
| SMILES | CCCCCCCCCc1ccc(NCC)cc1 |
| InChI | InChI=1S/C17H29N/c1-3-5-6-7-8-9-10-11-16-12-14-17(15-13-16)18-4-2/h12-15,18H,3-11H2,1-2H3 |
| InChIKey | SXJISEDPERCKTO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-4-nonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-nonylaniline?
The IUPAC name of N-ethyl-4-nonylaniline (CID 154108619) is N-ethyl-4-nonylaniline.
What is the SMILES notation for N-ethyl-4-nonylaniline?
The canonical SMILES for N-ethyl-4-nonylaniline is CCCCCCCCCc1ccc(NCC)cc1.
What is the InChIKey of N-ethyl-4-nonylaniline?
The InChIKey is SXJISEDPERCKTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N/c1-3-5-6-7-8-9-10-11-16-12-14-17(15-13-16)18-4-2/h12-15,18H,3-11H2,1-2H3.
What are the key properties of N-ethyl-4-nonylaniline?
N-ethyl-4-nonylaniline has a molecular weight of 247.43 g/mol, XLogP of 5.41, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-nonylaniline is sourced from PubChem (CID 154108619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).