C17H14Cl2N2OS — CID 71814305
2-[4-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]ethanol (PubChem CID 71814305) has the molecular formula C17H14Cl2N2OS and a molecular weight of 365.29 g/mol. Its IUPAC name is 2-[4-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]ethanol.
| Compound Name | 2-[4-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]ethanol |
|---|---|
| PubChem CID | 71814305 |
| Molecular Formula | C17H14Cl2N2OS |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 2-[4-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]ethanol |
| SMILES | OCCc1ccc(Nc2nc(-c3ccc(Cl)c(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C17H14Cl2N2OS/c18-14-6-3-12(9-15(14)19)16-10-23-17(21-16)20-13-4-1-11(2-5-13)7-8-22/h1-6,9-10,22H,7-8H2,(H,20,21) |
| InChIKey | BCDOVFWIVRJJHD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |