C17H12Cl3N3OS — CID 42764618
2-chloro-N-[4-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]phenyl]acetamide (PubChem CID 42764618) has the molecular formula C17H12Cl3N3OS and a molecular weight of 412.73 g/mol. Its IUPAC name is 2-chloro-N-[4-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 42764618 |
| Molecular Formula | C17H12Cl3N3OS |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | 2-chloro-N-[4-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(-c2csc(Nc3ccc(Cl)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C17H12Cl3N3OS/c18-8-16(24)21-11-3-1-10(2-4-11)15-9-25-17(23-15)22-12-5-6-13(19)14(20)7-12/h1-7,9H,8H2,(H,21,24)(H,22,23) |
| InChIKey | AZZVSRGWLINMTJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|