C19H16ClN3O2S — CID 142697324
N-[4-[2-(3-chloro-4-methoxyanilino)-1,3-thiazol-4-yl]phenyl]prop-2-enamide (PubChem CID 142697324) has the molecular formula C19H16ClN3O2S and a molecular weight of 385.88 g/mol. Its IUPAC name is N-[4-[2-(3-chloro-4-methoxyanilino)-1,3-thiazol-4-yl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[2-(3-chloro-4-methoxyanilino)-1,3-thiazol-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 142697324 |
| Molecular Formula | C19H16ClN3O2S |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[4-[2-(3-chloro-4-methoxyanilino)-1,3-thiazol-4-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(-c2csc(Nc3ccc(OC)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C19H16ClN3O2S/c1-3-18(24)21-13-6-4-12(5-7-13)16-11-26-19(23-16)22-14-8-9-17(25-2)15(20)10-14/h3-11H,1H2,2H3,(H,21,24)(H,22,23) |
| InChIKey | HHHLJSIFFAVRQP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|