C16H12BrClN2OS — CID 142697325
4-(4-bromophenyl)-N-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 142697325) has the molecular formula C16H12BrClN2OS and a molecular weight of 395.71 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-bromophenyl)-N-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 142697325 |
| Molecular Formula | C16H12BrClN2OS |
| Molecular Weight | 395.71 g/mol |
| Exact Mass | 393.95 |
| IUPAC Name | 4-(4-bromophenyl)-N-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(Nc2nc(-c3ccc(Br)cc3)cs2)cc1Cl |
| InChI | InChI=1S/C16H12BrClN2OS/c1-21-15-7-6-12(8-13(15)18)19-16-20-14(9-22-16)10-2-4-11(17)5-3-10/h2-9H,1H3,(H,19,20) |
| InChIKey | YDXFNIRUVGUJER-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.71 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |