C15H8BrCl3N2S — CID 151197403
4-(4-bromophenyl)-N-(2,4,6-trichlorophenyl)-1,3-thiazol-2-amine (PubChem CID 151197403) has the molecular formula C15H8BrCl3N2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-(2,4,6-trichlorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-bromophenyl)-N-(2,4,6-trichlorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 151197403 |
| Molecular Formula | C15H8BrCl3N2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 431.87 |
| IUPAC Name | 4-(4-bromophenyl)-N-(2,4,6-trichlorophenyl)-1,3-thiazol-2-amine |
| SMILES | Clc1cc(Cl)c(Nc2nc(-c3ccc(Br)cc3)cs2)c(Cl)c1 |
| InChI | InChI=1S/C15H8BrCl3N2S/c16-9-3-1-8(2-4-9)13-7-22-15(20-13)21-14-11(18)5-10(17)6-12(14)19/h1-7H,(H,20,21) |
| InChIKey | NHOZRHGQJBQINJ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |