C15H11ClN2OS — CID 877802
3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol (PubChem CID 877802) has the molecular formula C15H11ClN2OS and a molecular weight of 302.79 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol.
| Compound Name | 3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol |
|---|---|
| PubChem CID | 877802 |
| Molecular Formula | C15H11ClN2OS |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol |
| SMILES | Oc1cccc(Nc2nc(-c3ccc(Cl)cc3)cs2)c1 |
| InChI | InChI=1S/C15H11ClN2OS/c16-11-6-4-10(5-7-11)14-9-20-15(18-14)17-12-2-1-3-13(19)8-12/h1-9,19H,(H,17,18) |
| InChIKey | YCEGQPBMEPVITP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |