C18H14ClN3OS — CID 173040471
3-[(3E)-3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]prop-1-enyl]phenol (PubChem CID 173040471) has the molecular formula C18H14ClN3OS and a molecular weight of 355.85 g/mol. Its IUPAC name is 3-[(3E)-3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]prop-1-enyl]phenol.
| Compound Name | 3-[(3E)-3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]prop-1-enyl]phenol |
|---|---|
| PubChem CID | 173040471 |
| Molecular Formula | C18H14ClN3OS |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 3-[(3E)-3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]prop-1-enyl]phenol |
| SMILES | Oc1cccc(C=C/C=N/Nc2nc(-c3ccc(Cl)cc3)cs2)c1 |
| InChI | InChI=1S/C18H14ClN3OS/c19-15-8-6-14(7-9-15)17-12-24-18(21-17)22-20-10-2-4-13-3-1-5-16(23)11-13/h1-12,23H,(H,21,22)/b4-2?,20-10+ |
| InChIKey | LAWSDOLLQAZRPD-UXFXDHAXSA-N |
| XLogP | 5.28 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|