C17H14ClN3O3S — CID 136503698
2-[(E)-N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-C-methylcarbonimidoyl]benzene-1,3,5-triol (PubChem CID 136503698) has the molecular formula C17H14ClN3O3S and a molecular weight of 375.84 g/mol. Its IUPAC name is 2-[(E)-N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-C-methylcarbonimidoyl]benzene-1,3,5-triol.
| Compound Name | 2-[(E)-N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-C-methylcarbonimidoyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 136503698 |
| Molecular Formula | C17H14ClN3O3S |
| Molecular Weight | 375.84 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 2-[(E)-N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-C-methylcarbonimidoyl]benzene-1,3,5-triol |
| SMILES | C/C(=N\Nc1nc(-c2ccc(Cl)cc2)cs1)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C17H14ClN3O3S/c1-9(16-14(23)6-12(22)7-15(16)24)20-21-17-19-13(8-25-17)10-2-4-11(18)5-3-10/h2-8,22-24H,1H3,(H,19,21)/b20-9+ |
| InChIKey | DMXPWALUTRHWNF-AWQFTUOYSA-N |
| XLogP | 4.42 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|