C17H13Cl2N3OS — CID 171978845
4-[2-[(2E)-2-[1-(3,4-dichlorophenyl)ethylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol (PubChem CID 171978845) has the molecular formula C17H13Cl2N3OS and a molecular weight of 378.28 g/mol. Its IUPAC name is 4-[2-[(2E)-2-[1-(3,4-dichlorophenyl)ethylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol.
| Compound Name | 4-[2-[(2E)-2-[1-(3,4-dichlorophenyl)ethylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 171978845 |
| Molecular Formula | C17H13Cl2N3OS |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 4-[2-[(2E)-2-[1-(3,4-dichlorophenyl)ethylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol |
| SMILES | C/C(=N\Nc1nc(-c2ccc(O)cc2)cs1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2N3OS/c1-10(12-4-7-14(18)15(19)8-12)21-22-17-20-16(9-24-17)11-2-5-13(23)6-3-11/h2-9,23H,1H3,(H,20,22)/b21-10+ |
| InChIKey | JXFPNVAFCXJJRB-UFFVCSGVSA-N |
| XLogP | 5.66 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|