C18H17Br2N3S — CID 90484377
4-(4-bromophenyl)-N-[(E)-1-(4-methylphenyl)ethylideneamino]-1,3-thiazol-2-amine;hydrobromide (PubChem CID 90484377) has the molecular formula C18H17Br2N3S and a molecular weight of 467.23 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-[(E)-1-(4-methylphenyl)ethylideneamino]-1,3-thiazol-2-amine;hydrobromide.
| Compound Name | 4-(4-bromophenyl)-N-[(E)-1-(4-methylphenyl)ethylideneamino]-1,3-thiazol-2-amine;hydrobromide |
|---|---|
| PubChem CID | 90484377 |
| Molecular Formula | C18H17Br2N3S |
| Molecular Weight | 467.23 g/mol |
| Exact Mass | 464.95 |
| IUPAC Name | 4-(4-bromophenyl)-N-[(E)-1-(4-methylphenyl)ethylideneamino]-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.C/C(=N\Nc1nc(-c2ccc(Br)cc2)cs1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H16BrN3S.BrH/c1-12-3-5-14(6-4-12)13(2)21-22-18-20-17(11-23-18)15-7-9-16(19)10-8-15;/h3-11H,1-2H3,(H,20,22);1H/b21-13+; |
| InChIKey | WYHIORLQZONGOM-PGCULMPHSA-N |
| XLogP | 6.30 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.23 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|